C29H38N4O2 — CID 142887037
3-[1-[[(2R)-1-(3,4-diethylphenyl)-3-oxopent-4-en-2-yl]amino]piperidin-4-yl]-4,5-dihydro-1H-1,3-benzodiazepin-2-one (PubChem CID 142887037) has the molecular formula C29H38N4O2 and a molecular weight of 474.65 g/mol. Its IUPAC name is 3-[1-[[(2R)-1-(3,4-diethylphenyl)-3-oxopent-4-en-2-yl]amino]piperidin-4-yl]-4,5-dihydro-1H-1,3-benzodiazepin-2-one.
| Compound Name | 3-[1-[[(2R)-1-(3,4-diethylphenyl)-3-oxopent-4-en-2-yl]amino]piperidin-4-yl]-4,5-dihydro-1H-1,3-benzodiazepin-2-one |
|---|---|
| PubChem CID | 142887037 |
| Molecular Formula | C29H38N4O2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 3-[1-[[(2R)-1-(3,4-diethylphenyl)-3-oxopent-4-en-2-yl]amino]piperidin-4-yl]-4,5-dihydro-1H-1,3-benzodiazepin-2-one |
| SMILES | C=CC(=O)[C@@H](Cc1ccc(CC)c(CC)c1)NN1CCC(N2CCc3ccccc3NC2=O)CC1 |
| InChI | InChI=1S/C29H38N4O2/c1-4-22-12-11-21(19-23(22)5-2)20-27(28(34)6-3)31-32-16-14-25(15-17-32)33-18-13-24-9-7-8-10-26(24)30-29(33)35/h6-12,19,25,27,31H,3-5,13-18,20H2,1-2H3,(H,30,35)/t27-/m1/s1 |
| InChIKey | OJHZPWUCXBYAIC-HHHXNRCGSA-N |
| XLogP | 4.54 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|