About tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one
tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one (PubChem CID 142887236) has the molecular formula C17H24ClNO2
and a molecular weight of 309.84 g/mol. Its IUPAC name is tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one.
Molecular Properties
| Compound Name | tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one |
| PubChem CID | 142887236 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one |
| SMILES | CCC(=O)/C=C/c1cc(Cl)ccc1C.[H]/N=C/OC(C)(C)C |
| InChI | InChI=1S/C12H13ClO.C5H11NO/c1-3-12(14)7-5-10-8-11(13)6-4-9(10)2;1-5(2,3)7-4-6/h4-8H,3H2,1-2H3;4,6H,1-3H3/b7-5+;6-4+ |
| InChIKey | ZJKKSCHMPWYBGV-OJLQDYHYSA-N |
| XLogP | 5.05 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one?
The IUPAC name of tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one (CID 142887236) is tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one.
What is the SMILES notation for tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one?
The canonical SMILES for tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one is CCC(=O)/C=C/c1cc(Cl)ccc1C.[H]/N=C/OC(C)(C)C.
What is the InChIKey of tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one?
The InChIKey is ZJKKSCHMPWYBGV-OJLQDYHYSA-N. The full InChI is InChI=1S/C12H13ClO.C5H11NO/c1-3-12(14)7-5-10-8-11(13)6-4-9(10)2;1-5(2,3)7-4-6/h4-8H,3H2,1-2H3;4,6H,1-3H3/b7-5+;6-4+.
What are the key properties of tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one?
tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one has a molecular weight of 309.84 g/mol, XLogP of 5.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl methanimidate;(E)-1-(5-chloro-2-methylphenyl)pent-1-en-3-one is sourced from PubChem (CID 142887236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).