C27H44O5 — CID 142888385
17-(1-methoxybutoxy)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;methyl acetate (PubChem CID 142888385) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is 17-(1-methoxybutoxy)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;methyl acetate.
| Compound Name | 17-(1-methoxybutoxy)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;methyl acetate |
|---|---|
| PubChem CID | 142888385 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 17-(1-methoxybutoxy)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one;methyl acetate |
| SMILES | CCCC(OC)OC1CCC2C3CCC4=CC(=O)CCC4(C)C3CCC12C.COC(C)=O |
| InChI | InChI=1S/C24H38O3.C3H6O2/c1-5-6-22(26-4)27-21-10-9-19-18-8-7-16-15-17(25)11-13-23(16,2)20(18)12-14-24(19,21)3;1-3(4)5-2/h15,18-22H,5-14H2,1-4H3;1-2H3 |
| InChIKey | IUVDCHQWAGFEED-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|