C19H20F3N3O — CID 142888592
4-[(2Z,4Z)-cycloocta-2,4,7-trien-1-yl]-1-methylimidazole;1-methyl-5-(trifluoromethyl)pyridin-2-one (PubChem CID 142888592) has the molecular formula C19H20F3N3O and a molecular weight of 363.38 g/mol. Its IUPAC name is 4-[(2Z,4Z)-cycloocta-2,4,7-trien-1-yl]-1-methylimidazole;1-methyl-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 4-[(2Z,4Z)-cycloocta-2,4,7-trien-1-yl]-1-methylimidazole;1-methyl-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 142888592 |
| Molecular Formula | C19H20F3N3O |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-[(2Z,4Z)-cycloocta-2,4,7-trien-1-yl]-1-methylimidazole;1-methyl-5-(trifluoromethyl)pyridin-2-one |
| SMILES | Cn1cc(C(F)(F)F)ccc1=O.Cn1cnc(C2C=CC/C=C\C=C/2)c1 |
| InChI | InChI=1S/C12H14N2.C7H6F3NO/c1-14-9-12(13-10-14)11-7-5-3-2-4-6-8-11;1-11-4-5(7(8,9)10)2-3-6(11)12/h2-3,5-11H,4H2,1H3;2-4H,1H3/b3-2-,7-5-,8-6?; |
| InChIKey | QLYXESPKBOIPOV-XOXWXFDISA-N |
| XLogP | 3.98 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|