C34H41F3N6O2 — CID 142889122
N-[4-[6-[[amino-(2-aminophenyl)methylidene]amino]-2-[5-(2-ethylbutanoyl)-4-methyl-2-(trifluoromethyl)phenyl]-5-methylpyrimidin-4-yl]cyclohexyl]acetamide (PubChem CID 142889122) has the molecular formula C34H41F3N6O2 and a molecular weight of 622.74 g/mol. Its IUPAC name is N-[4-[6-[[amino-(2-aminophenyl)methylidene]amino]-2-[5-(2-ethylbutanoyl)-4-methyl-2-(trifluoromethyl)phenyl]-5-methylpyrimidin-4-yl]cyclohexyl]acetamide.
| Compound Name | N-[4-[6-[[amino-(2-aminophenyl)methylidene]amino]-2-[5-(2-ethylbutanoyl)-4-methyl-2-(trifluoromethyl)phenyl]-5-methylpyrimidin-4-yl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 142889122 |
| Molecular Formula | C34H41F3N6O2 |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | N-[4-[6-[[amino-(2-aminophenyl)methylidene]amino]-2-[5-(2-ethylbutanoyl)-4-methyl-2-(trifluoromethyl)phenyl]-5-methylpyrimidin-4-yl]cyclohexyl]acetamide |
| SMILES | CCC(CC)C(=O)c1cc(-c2nc(/N=C(\N)c3ccccc3N)c(C)c(C3CCC(NC(C)=O)CC3)n2)c(C(F)(F)F)cc1C |
| InChI | InChI=1S/C34H41F3N6O2/c1-6-21(7-2)30(45)25-17-26(27(16-18(25)3)34(35,36)37)33-41-29(22-12-14-23(15-13-22)40-20(5)44)19(4)32(43-33)42-31(39)24-10-8-9-11-28(24)38/h8-11,16-17,21-23H,6-7,12-15,38H2,1-5H3,(H,40,44)(H2,39,41,42,43) |
| InChIKey | IAXRNPPIFDEMFA-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|