C28H30N4 — CID 142889942
6-[2-[5-(4-methylphenyl)-2-pyridinyl]ethynyl]-2-(pyrrolidin-1-ylmethyl)-3,4-dihydro-2H-quinolin-1-amine (PubChem CID 142889942) has the molecular formula C28H30N4 and a molecular weight of 422.58 g/mol. Its IUPAC name is 6-[2-[5-(4-methylphenyl)-2-pyridinyl]ethynyl]-2-(pyrrolidin-1-ylmethyl)-3,4-dihydro-2H-quinolin-1-amine.
| Compound Name | 6-[2-[5-(4-methylphenyl)-2-pyridinyl]ethynyl]-2-(pyrrolidin-1-ylmethyl)-3,4-dihydro-2H-quinolin-1-amine |
|---|---|
| PubChem CID | 142889942 |
| Molecular Formula | C28H30N4 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 6-[2-[5-(4-methylphenyl)-2-pyridinyl]ethynyl]-2-(pyrrolidin-1-ylmethyl)-3,4-dihydro-2H-quinolin-1-amine |
| SMILES | Cc1ccc(-c2ccc(C#Cc3ccc4c(c3)CCC(CN3CCCC3)N4N)nc2)cc1 |
| InChI | InChI=1S/C28H30N4/c1-21-4-8-23(9-5-21)25-10-13-26(30-19-25)12-6-22-7-15-28-24(18-22)11-14-27(32(28)29)20-31-16-2-3-17-31/h4-5,7-10,13,15,18-19,27H,2-3,11,14,16-17,20,29H2,1H3 |
| InChIKey | IBOFYFVPTCFPFC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|