About (Z)-3,4-dimethylhex-3-ene;ethane
(Z)-3,4-dimethylhex-3-ene;ethane (PubChem CID 142890528) has the molecular formula C10H22
and a molecular weight of 142.29 g/mol. Its IUPAC name is (Z)-3,4-dimethylhex-3-ene;ethane.
Molecular Properties
| Compound Name | (Z)-3,4-dimethylhex-3-ene;ethane |
| PubChem CID | 142890528 |
| Molecular Formula | C10H22 |
| Molecular Weight | 142.29 g/mol |
| Exact Mass | 142.17 |
| IUPAC Name | (Z)-3,4-dimethylhex-3-ene;ethane |
| SMILES | CC.CC/C(C)=C(/C)CC |
| InChI | InChI=1S/C8H16.C2H6/c1-5-7(3)8(4)6-2;1-2/h5-6H2,1-4H3;1-2H3/b8-7-; |
| InChIKey | GIFJKEQNDPJCOZ-CFYXSCKTSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,4-dimethylhex-3-ene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,4-dimethylhex-3-ene;ethane?
The IUPAC name of (Z)-3,4-dimethylhex-3-ene;ethane (CID 142890528) is (Z)-3,4-dimethylhex-3-ene;ethane.
What is the SMILES notation for (Z)-3,4-dimethylhex-3-ene;ethane?
The canonical SMILES for (Z)-3,4-dimethylhex-3-ene;ethane is CC.CC/C(C)=C(/C)CC.
What is the InChIKey of (Z)-3,4-dimethylhex-3-ene;ethane?
The InChIKey is GIFJKEQNDPJCOZ-CFYXSCKTSA-N. The full InChI is InChI=1S/C8H16.C2H6/c1-5-7(3)8(4)6-2;1-2/h5-6H2,1-4H3;1-2H3/b8-7-;.
What are the key properties of (Z)-3,4-dimethylhex-3-ene;ethane?
(Z)-3,4-dimethylhex-3-ene;ethane has a molecular weight of 142.29 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,4-dimethylhex-3-ene;ethane is sourced from PubChem (CID 142890528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).