C25H36O3 — CID 142891744
2-[4-[(Z,2E)-3-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylidenepent-3-enoxy]cyclohexa-1,5-dien-1-yl]ethyl formate;ethane (PubChem CID 142891744) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is 2-[4-[(Z,2E)-3-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylidenepent-3-enoxy]cyclohexa-1,5-dien-1-yl]ethyl formate;ethane.
| Compound Name | 2-[4-[(Z,2E)-3-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylidenepent-3-enoxy]cyclohexa-1,5-dien-1-yl]ethyl formate;ethane |
|---|---|
| PubChem CID | 142891744 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 2-[4-[(Z,2E)-3-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethylidenepent-3-enoxy]cyclohexa-1,5-dien-1-yl]ethyl formate;ethane |
| SMILES | C/C=C(CC1=CCCC=C1)\C(=C/C)COC1C=CC(CCOC=O)=CC1.CC |
| InChI | InChI=1S/C23H30O3.C2H6/c1-3-21(16-20-8-6-5-7-9-20)22(4-2)17-26-23-12-10-19(11-13-23)14-15-25-18-24;1-2/h3-4,6,8-12,18,23H,5,7,13-17H2,1-2H3;1-2H3/b21-3-,22-4-; |
| InChIKey | BBPPYRAHNDMVFF-FZVBWRMSSA-N |
| XLogP | 6.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|