About (Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine
(Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine (PubChem CID 142892588) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is (Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine.
Molecular Properties
| Compound Name | (Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine |
| PubChem CID | 142892588 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | (Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine |
| SMILES | C=C/C=N\c1c(C)ncn1C |
| InChI | InChI=1S/C8H11N3/c1-4-5-9-8-7(2)10-6-11(8)3/h4-6H,1H2,2-3H3/b9-5- |
| InChIKey | AQNGHSSOGHDIDO-UITAMQMPSA-N |
| XLogP | 1.62 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine?
The IUPAC name of (Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine (CID 142892588) is (Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine.
What is the SMILES notation for (Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine?
The canonical SMILES for (Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine is C=C/C=N\c1c(C)ncn1C.
What is the InChIKey of (Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine?
The InChIKey is AQNGHSSOGHDIDO-UITAMQMPSA-N. The full InChI is InChI=1S/C8H11N3/c1-4-5-9-8-7(2)10-6-11(8)3/h4-6H,1H2,2-3H3/b9-5-.
What are the key properties of (Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine?
(Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine has a molecular weight of 149.20 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(3,5-dimethylimidazol-4-yl)prop-2-en-1-imine is sourced from PubChem (CID 142892588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).