C11H16FN — CID 142892616
4-[(2E,4Z)-6-fluorohexa-2,4-dien-3-yl]-1,2,3,6-tetrahydropyridine (PubChem CID 142892616) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is 4-[(2E,4Z)-6-fluorohexa-2,4-dien-3-yl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[(2E,4Z)-6-fluorohexa-2,4-dien-3-yl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 142892616 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 4-[(2E,4Z)-6-fluorohexa-2,4-dien-3-yl]-1,2,3,6-tetrahydropyridine |
| SMILES | C/C=C(\C=C/CF)C1=CCNCC1 |
| InChI | InChI=1S/C11H16FN/c1-2-10(4-3-7-12)11-5-8-13-9-6-11/h2-5,13H,6-9H2,1H3/b4-3-,10-2+ |
| InChIKey | LNIYEOHVXBJELC-MXSDMKSISA-N |
| XLogP | 2.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|