C28H29F6IN6OS — CID 142892646
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[2-[carbamimidoyl(iodo)amino]-1,3-thiazol-4-yl]-4-(4-phenylpiperidin-1-yl)butanamide (PubChem CID 142892646) has the molecular formula C28H29F6IN6OS and a molecular weight of 738.54 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[2-[carbamimidoyl(iodo)amino]-1,3-thiazol-4-yl]-4-(4-phenylpiperidin-1-yl)butanamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[2-[carbamimidoyl(iodo)amino]-1,3-thiazol-4-yl]-4-(4-phenylpiperidin-1-yl)butanamide |
|---|---|
| PubChem CID | 142892646 |
| Molecular Formula | C28H29F6IN6OS |
| Molecular Weight | 738.54 g/mol |
| Exact Mass | 738.11 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[2-[carbamimidoyl(iodo)amino]-1,3-thiazol-4-yl]-4-(4-phenylpiperidin-1-yl)butanamide |
| SMILES | [H]/N=C(\N)N(I)c1nc(C(CCN2CCC(c3ccccc3)CC2)C(=O)NCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C28H29F6IN6OS/c29-27(30,31)20-12-17(13-21(14-20)28(32,33)34)15-38-24(42)22(23-16-43-26(39-23)41(35)25(36)37)8-11-40-9-6-19(7-10-40)18-4-2-1-3-5-18/h1-5,12-14,16,19,22H,6-11,15H2,(H3,36,37)(H,38,42) |
| InChIKey | HWXULPQNPZBIIE-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.54 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|