C9H15NS — CID 142892711
4-(2,3-dihydrothiophen-3-yl)piperidine (PubChem CID 142892711) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is 4-(2,3-dihydrothiophen-3-yl)piperidine.
| Compound Name | 4-(2,3-dihydrothiophen-3-yl)piperidine |
|---|---|
| PubChem CID | 142892711 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-(2,3-dihydrothiophen-3-yl)piperidine |
| SMILES | C1=CC(C2CCNCC2)CS1 |
| InChI | InChI=1S/C9H15NS/c1-4-10-5-2-8(1)9-3-6-11-7-9/h3,6,8-10H,1-2,4-5,7H2 |
| InChIKey | AENMZFJJALKBSG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |