C21H32O2 — CID 142893287
17-hydroxy-3,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carbaldehyde (PubChem CID 142893287) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 17-hydroxy-3,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carbaldehyde.
| Compound Name | 17-hydroxy-3,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carbaldehyde |
|---|---|
| PubChem CID | 142893287 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 17-hydroxy-3,10,13-trimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3-carbaldehyde |
| SMILES | CC1(C=O)C=C2CCC3C(CCC4(C)C(O)CCC34)C2(C)CC1 |
| InChI | InChI=1S/C21H32O2/c1-19(13-22)10-11-20(2)14(12-19)4-5-15-16-6-7-18(23)21(16,3)9-8-17(15)20/h12-13,15-18,23H,4-11H2,1-3H3 |
| InChIKey | IWCCRWBYUCTPIM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|