About 2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone
2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone (PubChem CID 142893884) has the molecular formula C27H21BrF3OP
and a molecular weight of 529.34 g/mol. Its IUPAC name is 2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone.
Molecular Properties
| Compound Name | 2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone |
| PubChem CID | 142893884 |
| Molecular Formula | C27H21BrF3OP |
| Molecular Weight | 529.34 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | 2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H21BrF3OP/c28-33(23-10-4-1-5-11-23,24-12-6-2-7-13-24,25-14-8-3-9-15-25)20-26(32)21-16-18-22(19-17-21)27(29,30)31/h1-19H,20H2 |
| InChIKey | LKUDQAGDJIBOKY-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.34 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone?
The IUPAC name of 2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone (CID 142893884) is 2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone.
What is the SMILES notation for 2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone?
The canonical SMILES for 2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone is O=C(CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone?
The InChIKey is LKUDQAGDJIBOKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21BrF3OP/c28-33(23-10-4-1-5-11-23,24-12-6-2-7-13-24,25-14-8-3-9-15-25)20-26(32)21-16-18-22(19-17-21)27(29,30)31/h1-19H,20H2.
What are the key properties of 2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone?
2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone has a molecular weight of 529.34 g/mol, XLogP of 6.73, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bromo(triphenyl)-λ5-phosphanyl]-1-[4-(trifluoromethyl)phenyl]ethanone is sourced from PubChem (CID 142893884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).