C23H25Cl2NO2 — CID 142894445
11-(2,4-dichlorophenyl)-11-azapentacyclo[6.6.1.13,6.02,7.09,13]hexadec-4-ene-10,12-dione;ethane (PubChem CID 142894445) has the molecular formula C23H25Cl2NO2 and a molecular weight of 418.36 g/mol. Its IUPAC name is 11-(2,4-dichlorophenyl)-11-azapentacyclo[6.6.1.13,6.02,7.09,13]hexadec-4-ene-10,12-dione;ethane.
| Compound Name | 11-(2,4-dichlorophenyl)-11-azapentacyclo[6.6.1.13,6.02,7.09,13]hexadec-4-ene-10,12-dione;ethane |
|---|---|
| PubChem CID | 142894445 |
| Molecular Formula | C23H25Cl2NO2 |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 11-(2,4-dichlorophenyl)-11-azapentacyclo[6.6.1.13,6.02,7.09,13]hexadec-4-ene-10,12-dione;ethane |
| SMILES | CC.O=C1C2CC3CC(C2C(=O)N1c1ccc(Cl)cc1Cl)C1C2C=CC(C2)C31 |
| InChI | InChI=1S/C21H19Cl2NO2.C2H6/c22-12-3-4-16(15(23)8-12)24-20(25)14-7-11-6-13(19(14)21(24)26)18-10-2-1-9(5-10)17(11)18;1-2/h1-4,8-11,13-14,17-19H,5-7H2;1-2H3 |
| InChIKey | YGPHMGWBQWXSAA-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|