C8H18O2 — CID 142894626
5,5-dimethyloxolan-2-ol;ethane (PubChem CID 142894626) has the molecular formula C8H18O2 and a molecular weight of 146.23 g/mol. Its IUPAC name is 5,5-dimethyloxolan-2-ol;ethane.
| Compound Name | 5,5-dimethyloxolan-2-ol;ethane |
|---|---|
| PubChem CID | 142894626 |
| Molecular Formula | C8H18O2 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | 5,5-dimethyloxolan-2-ol;ethane |
| SMILES | CC.CC1(C)CCC(O)O1 |
| InChI | InChI=1S/C6H12O2.C2H6/c1-6(2)4-3-5(7)8-6;1-2/h5,7H,3-4H2,1-2H3;1-2H3 |
| InChIKey | QAOACWPVEBGGIT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |