About 2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride
2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride (PubChem CID 142894828) has the molecular formula C12H10ClNO2
and a molecular weight of 235.67 g/mol. Its IUPAC name is 2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride.
Molecular Properties
| Compound Name | 2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride |
| PubChem CID | 142894828 |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride |
| SMILES | CC1=CC=c2[nH]cc(C(=O)C(=O)Cl)c2=CC1 |
| InChI | InChI=1S/C12H10ClNO2/c1-7-2-4-8-9(11(15)12(13)16)6-14-10(8)5-3-7/h3-6,14H,2H2,1H3 |
| InChIKey | CCMRDHCCMZKDKM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride?
The IUPAC name of 2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride (CID 142894828) is 2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride.
What is the SMILES notation for 2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride?
The canonical SMILES for 2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride is CC1=CC=c2[nH]cc(C(=O)C(=O)Cl)c2=CC1.
What is the InChIKey of 2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride?
The InChIKey is CCMRDHCCMZKDKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO2/c1-7-2-4-8-9(11(15)12(13)16)6-14-10(8)5-3-7/h3-6,14H,2H2,1H3.
What are the key properties of 2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride?
2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride has a molecular weight of 235.67 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-1,5-dihydrocyclohepta[b]pyrrol-3-yl)-2-oxoacetyl chloride is sourced from PubChem (CID 142894828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).