About tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate
tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate (PubChem CID 142894888) has the molecular formula C18H25NO3
and a molecular weight of 303.40 g/mol. Its IUPAC name is tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate |
| PubChem CID | 142894888 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=C(C=O)C2=CCCC=C2)CC1 |
| InChI | InChI=1S/C18H25NO3/c1-18(2,3)22-17(21)19-11-9-15(10-12-19)16(13-20)14-7-5-4-6-8-14/h5,7-8,13H,4,6,9-12H2,1-3H3 |
| InChIKey | REUPUNSCZYANGL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate (CID 142894888) is tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(=C(C=O)C2=CCCC=C2)CC1.
What is the InChIKey of tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate?
The InChIKey is REUPUNSCZYANGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO3/c1-18(2,3)22-17(21)19-11-9-15(10-12-19)16(13-20)14-7-5-4-6-8-14/h5,7-8,13H,4,6,9-12H2,1-3H3.
What are the key properties of tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate?
tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate has a molecular weight of 303.40 g/mol, XLogP of 3.79, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(1-cyclohexa-1,5-dien-1-yl-2-oxoethylidene)piperidine-1-carboxylate is sourced from PubChem (CID 142894888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).