C14H13NO — CID 142894990
2-buta-1,3-dien-2-yl-7-methyl-1H-quinolin-4-one (PubChem CID 142894990) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yl-7-methyl-1H-quinolin-4-one.
| Compound Name | 2-buta-1,3-dien-2-yl-7-methyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 142894990 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-buta-1,3-dien-2-yl-7-methyl-1H-quinolin-4-one |
| SMILES | C=CC(=C)c1cc(=O)c2ccc(C)cc2[nH]1 |
| InChI | InChI=1S/C14H13NO/c1-4-10(3)12-8-14(16)11-6-5-9(2)7-13(11)15-12/h4-8H,1,3H2,2H3,(H,15,16) |
| InChIKey | KUAATKDCFGUPRT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|