About (3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide
(3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide (PubChem CID 142895068) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is (3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide.
Molecular Properties
| Compound Name | (3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide |
| PubChem CID | 142895068 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide |
| SMILES | C=C=C[C@H](C)C(NC=O)C(=O)NC |
| InChI | InChI=1S/C9H14N2O2/c1-4-5-7(2)8(11-6-12)9(13)10-3/h5-8H,1H2,2-3H3,(H,10,13)(H,11,12)/t7-,8?/m0/s1 |
| InChIKey | VRZYGDRNSVQDMM-JAMMHHFISA-N |
| XLogP | -0.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide?
The IUPAC name of (3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide (CID 142895068) is (3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide.
What is the SMILES notation for (3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide?
The canonical SMILES for (3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide is C=C=C[C@H](C)C(NC=O)C(=O)NC.
What is the InChIKey of (3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide?
The InChIKey is VRZYGDRNSVQDMM-JAMMHHFISA-N. The full InChI is InChI=1S/C9H14N2O2/c1-4-5-7(2)8(11-6-12)9(13)10-3/h5-8H,1H2,2-3H3,(H,10,13)(H,11,12)/t7-,8?/m0/s1.
What are the key properties of (3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide?
(3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide has a molecular weight of 182.22 g/mol, XLogP of -0.18, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2-formamido-N,3-dimethylhexa-4,5-dienamide is sourced from PubChem (CID 142895068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).