About N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide
N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide (PubChem CID 142895285) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide.
Molecular Properties
| Compound Name | N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide |
| PubChem CID | 142895285 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide |
| SMILES | C=C/C(=C\C)NC(=O)CCCCCCC(=O)NO |
| InChI | InChI=1S/C13H22N2O3/c1-3-11(4-2)14-12(16)9-7-5-6-8-10-13(17)15-18/h3-4,18H,1,5-10H2,2H3,(H,14,16)(H,15,17)/b11-4+ |
| InChIKey | WLTRTNKADDXCBD-NYYWCZLTSA-N |
| XLogP | 2.04 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide?
The IUPAC name of N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide (CID 142895285) is N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide.
What is the SMILES notation for N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide?
The canonical SMILES for N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide is C=C/C(=C\C)NC(=O)CCCCCCC(=O)NO.
What is the InChIKey of N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide?
The InChIKey is WLTRTNKADDXCBD-NYYWCZLTSA-N. The full InChI is InChI=1S/C13H22N2O3/c1-3-11(4-2)14-12(16)9-7-5-6-8-10-13(17)15-18/h3-4,18H,1,5-10H2,2H3,(H,14,16)(H,15,17)/b11-4+.
What are the key properties of N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide?
N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide has a molecular weight of 254.33 g/mol, XLogP of 2.04, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-N-[(3E)-penta-1,3-dien-3-yl]octanediamide is sourced from PubChem (CID 142895285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).