C25H35N3O3 — CID 142895397
1-[1-[2-[(4aS,8aR)-8a-methyl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2-oxoethyl]-6-methoxyindazol-3-yl]-2,2-dimethylpropan-1-one (PubChem CID 142895397) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is 1-[1-[2-[(4aS,8aR)-8a-methyl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2-oxoethyl]-6-methoxyindazol-3-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[1-[2-[(4aS,8aR)-8a-methyl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2-oxoethyl]-6-methoxyindazol-3-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 142895397 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 1-[1-[2-[(4aS,8aR)-8a-methyl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2-oxoethyl]-6-methoxyindazol-3-yl]-2,2-dimethylpropan-1-one |
| SMILES | COc1ccc2c(C(=O)C(C)(C)C)nn(CC(=O)N3CC[C@@H]4CCCC[C@@]4(C)C3)c2c1 |
| InChI | InChI=1S/C25H35N3O3/c1-24(2,3)23(30)22-19-10-9-18(31-5)14-20(19)28(26-22)15-21(29)27-13-11-17-8-6-7-12-25(17,4)16-27/h9-10,14,17H,6-8,11-13,15-16H2,1-5H3/t17-,25-/m0/s1 |
| InChIKey | LPXODWWGKKGCOS-GKVSMKOHSA-N |
| XLogP | 4.70 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |