C27H30N2O4S — CID 142895523
4-[4-[3-[3-(4-aminophenyl)phenyl]propoxy]phenyl]sulfinyloxane-4-carboxamide (PubChem CID 142895523) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is 4-[4-[3-[3-(4-aminophenyl)phenyl]propoxy]phenyl]sulfinyloxane-4-carboxamide.
| Compound Name | 4-[4-[3-[3-(4-aminophenyl)phenyl]propoxy]phenyl]sulfinyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142895523 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 4-[4-[3-[3-(4-aminophenyl)phenyl]propoxy]phenyl]sulfinyloxane-4-carboxamide |
| SMILES | NC(=O)C1(S(=O)c2ccc(OCCCc3cccc(-c4ccc(N)cc4)c3)cc2)CCOCC1 |
| InChI | InChI=1S/C27H30N2O4S/c28-23-8-6-21(7-9-23)22-5-1-3-20(19-22)4-2-16-33-24-10-12-25(13-11-24)34(31)27(26(29)30)14-17-32-18-15-27/h1,3,5-13,19H,2,4,14-18,28H2,(H2,29,30) |
| InChIKey | PUYPMYVWTZTYHR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|