C29H36N2O6S2 — CID 142895648
N-hydroxy-1-(2-methoxyethyl)-2-methyl-4-[4-[3-(3-thiophen-2-ylphenyl)propoxy]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 142895648) has the molecular formula C29H36N2O6S2 and a molecular weight of 572.75 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-2-methyl-4-[4-[3-(3-thiophen-2-ylphenyl)propoxy]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-2-methyl-4-[4-[3-(3-thiophen-2-ylphenyl)propoxy]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 142895648 |
| Molecular Formula | C29H36N2O6S2 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-2-methyl-4-[4-[3-(3-thiophen-2-ylphenyl)propoxy]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(OCCCc3cccc(-c4cccs4)c3)cc2)CC1C |
| InChI | InChI=1S/C29H36N2O6S2/c1-22-21-29(28(32)30-33,14-15-31(22)16-18-36-2)39(34,35)26-12-10-25(11-13-26)37-17-4-7-23-6-3-8-24(20-23)27-9-5-19-38-27/h3,5-6,8-13,19-20,22,33H,4,7,14-18,21H2,1-2H3,(H,30,32) |
| InChIKey | WOTPATSMVPHQRT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|