C20H22F3N3O7S2 — CID 142896154
N-[3-[(3R)-1-methylpyrrolidin-3-yl]oxy-4-(trifluoromethyl)phenyl]-4-nitro-5-(oxolan-3-yloxy)thiophene-2-sulfonamide (PubChem CID 142896154) has the molecular formula C20H22F3N3O7S2 and a molecular weight of 537.54 g/mol. Its IUPAC name is N-[3-[(3R)-1-methylpyrrolidin-3-yl]oxy-4-(trifluoromethyl)phenyl]-4-nitro-5-(oxolan-3-yloxy)thiophene-2-sulfonamide.
| Compound Name | N-[3-[(3R)-1-methylpyrrolidin-3-yl]oxy-4-(trifluoromethyl)phenyl]-4-nitro-5-(oxolan-3-yloxy)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 142896154 |
| Molecular Formula | C20H22F3N3O7S2 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | N-[3-[(3R)-1-methylpyrrolidin-3-yl]oxy-4-(trifluoromethyl)phenyl]-4-nitro-5-(oxolan-3-yloxy)thiophene-2-sulfonamide |
| SMILES | CN1CC[C@@H](Oc2cc(NS(=O)(=O)c3cc([N+](=O)[O-])c(OC4CCOC4)s3)ccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C20H22F3N3O7S2/c1-25-6-4-13(10-25)32-17-8-12(2-3-15(17)20(21,22)23)24-35(29,30)18-9-16(26(27)28)19(34-18)33-14-5-7-31-11-14/h2-3,8-9,13-14,24H,4-7,10-11H2,1H3/t13-,14?/m1/s1 |
| InChIKey | LYBDOXRBCCHWQO-KWCCSABGSA-N |
| XLogP | 3.73 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|