About 5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine
5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine (PubChem CID 142896222) has the molecular formula C17H20F3N3OS
and a molecular weight of 371.43 g/mol. Its IUPAC name is 5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine.
Molecular Properties
| Compound Name | 5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine |
| PubChem CID | 142896222 |
| Molecular Formula | C17H20F3N3OS |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine |
| SMILES | C1CCNC1.Nc1ccc(SNc2ccc(C(F)(F)F)c(O)c2)cc1 |
| InChI | InChI=1S/C13H11F3N2OS.C4H9N/c14-13(15,16)11-6-3-9(7-12(11)19)18-20-10-4-1-8(17)2-5-10;1-2-4-5-3-1/h1-7,18-19H,17H2;5H,1-4H2 |
| InChIKey | WDILQXVEDFKAJA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine?
The IUPAC name of 5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine (CID 142896222) is 5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine.
What is the SMILES notation for 5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine?
The canonical SMILES for 5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine is C1CCNC1.Nc1ccc(SNc2ccc(C(F)(F)F)c(O)c2)cc1.
What is the InChIKey of 5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine?
The InChIKey is WDILQXVEDFKAJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2OS.C4H9N/c14-13(15,16)11-6-3-9(7-12(11)19)18-20-10-4-1-8(17)2-5-10;1-2-4-5-3-1/h1-7,18-19H,17H2;5H,1-4H2.
What are the key properties of 5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine?
5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine has a molecular weight of 371.43 g/mol, XLogP of 4.48, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-aminophenyl)sulfanylamino]-2-(trifluoromethyl)phenol;pyrrolidine is sourced from PubChem (CID 142896222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).