C28H34F3N3O2S — CID 142896717
5,6-dihydro-4H-1,3-thiazin-2-yl-[4-[2-[9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]methanone (PubChem CID 142896717) has the molecular formula C28H34F3N3O2S and a molecular weight of 533.66 g/mol. Its IUPAC name is 5,6-dihydro-4H-1,3-thiazin-2-yl-[4-[2-[9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]methanone.
| Compound Name | 5,6-dihydro-4H-1,3-thiazin-2-yl-[4-[2-[9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]methanone |
|---|---|
| PubChem CID | 142896717 |
| Molecular Formula | C28H34F3N3O2S |
| Molecular Weight | 533.66 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 5,6-dihydro-4H-1,3-thiazin-2-yl-[4-[2-[9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]oxan-4-yl]methanone |
| SMILES | O=C(C1=NCCCS1)C1(CCN2CCC3Cc4[nH]c5ccc(C(F)(F)F)cc5c4CC3C2)CCOCC1 |
| InChI | InChI=1S/C28H34F3N3O2S/c29-28(30,31)20-2-3-23-22(16-20)21-14-19-17-34(9-4-18(19)15-24(21)33-23)10-5-27(6-11-36-12-7-27)25(35)26-32-8-1-13-37-26/h2-3,16,18-19,33H,1,4-15,17H2 |
| InChIKey | MPDGKFLMVANNKW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 57.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.66 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|