About ethane;6H-pyrido[4,3-b]carbazole
ethane;6H-pyrido[4,3-b]carbazole (PubChem CID 142896724) has the molecular formula C17H16N2
and a molecular weight of 248.33 g/mol. Its IUPAC name is ethane;6H-pyrido[4,3-b]carbazole.
Molecular Properties
| Compound Name | ethane;6H-pyrido[4,3-b]carbazole |
| PubChem CID | 142896724 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | ethane;6H-pyrido[4,3-b]carbazole |
| SMILES | CC.c1ccc2c(c1)[nH]c1cc3ccncc3cc12 |
| InChI | InChI=1S/C15H10N2.C2H6/c1-2-4-14-12(3-1)13-7-11-9-16-6-5-10(11)8-15(13)17-14;1-2/h1-9,17H;1-2H3 |
| InChIKey | ZRKZLOWHPLYQNH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;6H-pyrido[4,3-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6H-pyrido[4,3-b]carbazole?
The IUPAC name of ethane;6H-pyrido[4,3-b]carbazole (CID 142896724) is ethane;6H-pyrido[4,3-b]carbazole.
What is the SMILES notation for ethane;6H-pyrido[4,3-b]carbazole?
The canonical SMILES for ethane;6H-pyrido[4,3-b]carbazole is CC.c1ccc2c(c1)[nH]c1cc3ccncc3cc12.
What is the InChIKey of ethane;6H-pyrido[4,3-b]carbazole?
The InChIKey is ZRKZLOWHPLYQNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2.C2H6/c1-2-4-14-12(3-1)13-7-11-9-16-6-5-10(11)8-15(13)17-14;1-2/h1-9,17H;1-2H3.
What are the key properties of ethane;6H-pyrido[4,3-b]carbazole?
ethane;6H-pyrido[4,3-b]carbazole has a molecular weight of 248.33 g/mol, XLogP of 4.90, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6H-pyrido[4,3-b]carbazole is sourced from PubChem (CID 142896724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).