C26H29N9S — CID 142897389
2-[(E)-2-[4-[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]-2-propan-2-ylphenyl]ethenyl]-5-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]benzenethiol (PubChem CID 142897389) has the molecular formula C26H29N9S and a molecular weight of 499.65 g/mol. Its IUPAC name is 2-[(E)-2-[4-[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]-2-propan-2-ylphenyl]ethenyl]-5-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]benzenethiol.
| Compound Name | 2-[(E)-2-[4-[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]-2-propan-2-ylphenyl]ethenyl]-5-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]benzenethiol |
|---|---|
| PubChem CID | 142897389 |
| Molecular Formula | C26H29N9S |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 2-[(E)-2-[4-[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]-2-propan-2-ylphenyl]ethenyl]-5-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]benzenethiol |
| SMILES | Cc1nc(C)nc(Nc2ccc(/C=C/c3ccc(Nc4nc(C)nc(N)n4)cc3C(C)C)c(S)c2)n1 |
| InChI | InChI=1S/C26H29N9S/c1-14(2)22-12-20(33-26-32-17(5)29-24(27)35-26)10-8-18(22)6-7-19-9-11-21(13-23(19)36)34-25-30-15(3)28-16(4)31-25/h6-14,36H,1-5H3,(H,28,30,31,34)(H3,27,29,32,33,35)/b7-6+ |
| InChIKey | DNRLKCFIMCJDOA-VOTSOKGWSA-N |
| XLogP | 5.63 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|