C26H33N3 — CID 142897540
N-[1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylidene-1H-pyridazin-5-yl]ethenyl]-3-(3-propan-2-ylphenyl)propan-1-amine (PubChem CID 142897540) has the molecular formula C26H33N3 and a molecular weight of 387.57 g/mol. Its IUPAC name is N-[1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylidene-1H-pyridazin-5-yl]ethenyl]-3-(3-propan-2-ylphenyl)propan-1-amine.
| Compound Name | N-[1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylidene-1H-pyridazin-5-yl]ethenyl]-3-(3-propan-2-ylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 142897540 |
| Molecular Formula | C26H33N3 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | N-[1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methylidene-1H-pyridazin-5-yl]ethenyl]-3-(3-propan-2-ylphenyl)propan-1-amine |
| SMILES | C=C/C=C(\C=C/C)C1=NNC(=C)C(C(=C)NCCCc2cccc(C(C)C)c2)=C1 |
| InChI | InChI=1S/C26H33N3/c1-7-11-23(12-8-2)26-18-25(21(6)28-29-26)20(5)27-16-10-14-22-13-9-15-24(17-22)19(3)4/h7-9,11-13,15,17-19,27-28H,1,5-6,10,14,16H2,2-4H3/b12-8-,23-11+ |
| InChIKey | ZZRQJHRBUPDOGA-NGMJSWSKSA-N |
| XLogP | 5.93 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|