C12H17NO — CID 142897749
(2Z,5E)-5-ethenyl-7-ethylimino-4-methylidenehepta-2,5-dien-1-ol (PubChem CID 142897749) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (2Z,5E)-5-ethenyl-7-ethylimino-4-methylidenehepta-2,5-dien-1-ol.
| Compound Name | (2Z,5E)-5-ethenyl-7-ethylimino-4-methylidenehepta-2,5-dien-1-ol |
|---|---|
| PubChem CID | 142897749 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (2Z,5E)-5-ethenyl-7-ethylimino-4-methylidenehepta-2,5-dien-1-ol |
| SMILES | C=C/C(=C\C=N\CC)C(=C)/C=C\CO |
| InChI | InChI=1S/C12H17NO/c1-4-12(8-9-13-5-2)11(3)7-6-10-14/h4,6-9,14H,1,3,5,10H2,2H3/b7-6-,12-8+,13-9+ |
| InChIKey | MAXIOVVNCOKNRT-CYAJVYQESA-N |
| XLogP | 2.29 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|