C13H23N — CID 142898519
(1E,4Z)-2-butan-2-yl-N-prop-2-enylhexa-1,4-dien-1-amine (PubChem CID 142898519) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (1E,4Z)-2-butan-2-yl-N-prop-2-enylhexa-1,4-dien-1-amine.
| Compound Name | (1E,4Z)-2-butan-2-yl-N-prop-2-enylhexa-1,4-dien-1-amine |
|---|---|
| PubChem CID | 142898519 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (1E,4Z)-2-butan-2-yl-N-prop-2-enylhexa-1,4-dien-1-amine |
| SMILES | C=CCN/C=C(\C/C=C\C)C(C)CC |
| InChI | InChI=1S/C13H23N/c1-5-8-9-13(12(4)7-3)11-14-10-6-2/h5-6,8,11-12,14H,2,7,9-10H2,1,3-4H3/b8-5-,13-11+ |
| InChIKey | ZLQNXHYSWPNCID-JXSKNCHLSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|