About N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane
N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane (PubChem CID 142899187) has the molecular formula C28H31NO2
and a molecular weight of 413.56 g/mol. Its IUPAC name is N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane.
Molecular Properties
| Compound Name | N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane |
| PubChem CID | 142899187 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane |
| SMILES | CC.CC1(C)C=Cc2c(ccc3cc(CN(C(=O)C4CC4)c4ccccc4)ccc23)O1 |
| InChI | InChI=1S/C26H25NO2.C2H6/c1-26(2)15-14-23-22-12-8-18(16-20(22)11-13-24(23)29-26)17-27(25(28)19-9-10-19)21-6-4-3-5-7-21;1-2/h3-8,11-16,19H,9-10,17H2,1-2H3;1-2H3 |
| InChIKey | DUZPOQMZUDBHES-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane?
The IUPAC name of N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane (CID 142899187) is N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane.
What is the SMILES notation for N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane?
The canonical SMILES for N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane is CC.CC1(C)C=Cc2c(ccc3cc(CN(C(=O)C4CC4)c4ccccc4)ccc23)O1.
What is the InChIKey of N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane?
The InChIKey is DUZPOQMZUDBHES-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25NO2.C2H6/c1-26(2)15-14-23-22-12-8-18(16-20(22)11-13-24(23)29-26)17-27(25(28)19-9-10-19)21-6-4-3-5-7-21;1-2/h3-8,11-16,19H,9-10,17H2,1-2H3;1-2H3.
What are the key properties of N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane?
N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane has a molecular weight of 413.56 g/mol, XLogP of 6.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,3-dimethylbenzo[f]chromen-8-yl)methyl]-N-phenylcyclopropanecarboxamide;ethane is sourced from PubChem (CID 142899187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).