C31H28F3N3O3 — CID 142899755
1-[3-[4-(2-ethenyl-2-ethyl-3-hydroxybut-3-enyl)phenyl]phenyl]-4-oxo-N-(2,2,2-trifluoroethyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 142899755) has the molecular formula C31H28F3N3O3 and a molecular weight of 547.58 g/mol. Its IUPAC name is 1-[3-[4-(2-ethenyl-2-ethyl-3-hydroxybut-3-enyl)phenyl]phenyl]-4-oxo-N-(2,2,2-trifluoroethyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-[3-[4-(2-ethenyl-2-ethyl-3-hydroxybut-3-enyl)phenyl]phenyl]-4-oxo-N-(2,2,2-trifluoroethyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 142899755 |
| Molecular Formula | C31H28F3N3O3 |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 1-[3-[4-(2-ethenyl-2-ethyl-3-hydroxybut-3-enyl)phenyl]phenyl]-4-oxo-N-(2,2,2-trifluoroethyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | C=CC(CC)(Cc1ccc(-c2cccc(-n3cc(C(=O)NCC(F)(F)F)c(=O)c4cccnc43)c2)cc1)C(=C)O |
| InChI | InChI=1S/C31H28F3N3O3/c1-4-30(5-2,20(3)38)17-21-11-13-22(14-12-21)23-8-6-9-24(16-23)37-18-26(29(40)36-19-31(32,33)34)27(39)25-10-7-15-35-28(25)37/h4,6-16,18,38H,1,3,5,17,19H2,2H3,(H,36,40) |
| InChIKey | XYEUUOSXHHGBEZ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|