About 4-arsorosoaniline
4-arsorosoaniline (PubChem CID 14290) has the molecular formula C6H6AsNO
and a molecular weight of 183.04 g/mol. Its IUPAC name is 4-arsorosoaniline.
Molecular Properties
| Compound Name | 4-arsorosoaniline |
| PubChem CID | 14290 |
| Molecular Formula | C6H6AsNO |
| Molecular Weight | 183.04 g/mol |
| Exact Mass | 182.97 |
| IUPAC Name | 4-arsorosoaniline |
| SMILES | Nc1ccc([As]=O)cc1 |
| InChI | InChI=1S/C6H6AsNO/c8-6-3-1-5(7-9)2-4-6/h1-4H,8H2 |
| InChIKey | VOLTUGUMYQENMY-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.04 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-arsorosoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-arsorosoaniline?
The IUPAC name of 4-arsorosoaniline (CID 14290) is 4-arsorosoaniline.
What is the SMILES notation for 4-arsorosoaniline?
The canonical SMILES for 4-arsorosoaniline is Nc1ccc([As]=O)cc1.
What is the InChIKey of 4-arsorosoaniline?
The InChIKey is VOLTUGUMYQENMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6AsNO/c8-6-3-1-5(7-9)2-4-6/h1-4H,8H2.
What are the key properties of 4-arsorosoaniline?
4-arsorosoaniline has a molecular weight of 183.04 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-arsorosoaniline is sourced from PubChem (CID 14290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).