About (3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane
(3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane (PubChem CID 142901240) has the molecular formula C8H20N3OP
and a molecular weight of 205.24 g/mol. Its IUPAC name is (3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane.
Molecular Properties
| Compound Name | (3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane |
| PubChem CID | 142901240 |
| Molecular Formula | C8H20N3OP |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane |
| SMILES | C/C(N)=N\C(=O)N(C)C(C)C.CP |
| InChI | InChI=1S/C7H15N3O.CH5P/c1-5(2)10(4)7(11)9-6(3)8;1-2/h5H,1-4H3,(H2,8,9,11);2H2,1H3 |
| InChIKey | AXEQPMROAUPNJH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane?
The IUPAC name of (3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane (CID 142901240) is (3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane.
What is the SMILES notation for (3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane?
The canonical SMILES for (3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane is C/C(N)=N\C(=O)N(C)C(C)C.CP.
What is the InChIKey of (3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane?
The InChIKey is AXEQPMROAUPNJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O.CH5P/c1-5(2)10(4)7(11)9-6(3)8;1-2/h5H,1-4H3,(H2,8,9,11);2H2,1H3.
What are the key properties of (3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane?
(3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane has a molecular weight of 205.24 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-(1-aminoethylidene)-1-methyl-1-propan-2-ylurea;methylphosphane is sourced from PubChem (CID 142901240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).