C20H31N3O3S — CID 142901387
ethane;1-(4-methylsulfonylphenyl)-3-propan-2-yloxy-5-prop-1-en-2-yl-1,2,4-triazole;prop-1-ene (PubChem CID 142901387) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is ethane;1-(4-methylsulfonylphenyl)-3-propan-2-yloxy-5-prop-1-en-2-yl-1,2,4-triazole;prop-1-ene.
| Compound Name | ethane;1-(4-methylsulfonylphenyl)-3-propan-2-yloxy-5-prop-1-en-2-yl-1,2,4-triazole;prop-1-ene |
|---|---|
| PubChem CID | 142901387 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | ethane;1-(4-methylsulfonylphenyl)-3-propan-2-yloxy-5-prop-1-en-2-yl-1,2,4-triazole;prop-1-ene |
| SMILES | C=C(C)c1nc(OC(C)C)nn1-c1ccc(S(C)(=O)=O)cc1.C=CC.CC |
| InChI | InChI=1S/C15H19N3O3S.C3H6.C2H6/c1-10(2)14-16-15(21-11(3)4)17-18(14)12-6-8-13(9-7-12)22(5,19)20;1-3-2;1-2/h6-9,11H,1H2,2-5H3;3H,1H2,2H3;1-2H3 |
| InChIKey | IOKGCKOGPMZVQE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|