About ethane;5-propyl-1,3-thiazolidine-2,4-dione
ethane;5-propyl-1,3-thiazolidine-2,4-dione (PubChem CID 142901565) has the molecular formula C8H15NO2S
and a molecular weight of 189.28 g/mol. Its IUPAC name is ethane;5-propyl-1,3-thiazolidine-2,4-dione.
Molecular Properties
| Compound Name | ethane;5-propyl-1,3-thiazolidine-2,4-dione |
| PubChem CID | 142901565 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | ethane;5-propyl-1,3-thiazolidine-2,4-dione |
| SMILES | CC.CCCC1SC(=O)NC1=O |
| InChI | InChI=1S/C6H9NO2S.C2H6/c1-2-3-4-5(8)7-6(9)10-4;1-2/h4H,2-3H2,1H3,(H,7,8,9);1-2H3 |
| InChIKey | HZANWKIQOZVLJT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-propyl-1,3-thiazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-propyl-1,3-thiazolidine-2,4-dione?
The IUPAC name of ethane;5-propyl-1,3-thiazolidine-2,4-dione (CID 142901565) is ethane;5-propyl-1,3-thiazolidine-2,4-dione.
What is the SMILES notation for ethane;5-propyl-1,3-thiazolidine-2,4-dione?
The canonical SMILES for ethane;5-propyl-1,3-thiazolidine-2,4-dione is CC.CCCC1SC(=O)NC1=O.
What is the InChIKey of ethane;5-propyl-1,3-thiazolidine-2,4-dione?
The InChIKey is HZANWKIQOZVLJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2S.C2H6/c1-2-3-4-5(8)7-6(9)10-4;1-2/h4H,2-3H2,1H3,(H,7,8,9);1-2H3.
What are the key properties of ethane;5-propyl-1,3-thiazolidine-2,4-dione?
ethane;5-propyl-1,3-thiazolidine-2,4-dione has a molecular weight of 189.28 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-propyl-1,3-thiazolidine-2,4-dione is sourced from PubChem (CID 142901565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).