C17H25NO3 — CID 142901652
2-[methyl-(2-methyl-4-pentan-3-ylbenzoyl)amino]propanoic acid (PubChem CID 142901652) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-[methyl-(2-methyl-4-pentan-3-ylbenzoyl)amino]propanoic acid.
| Compound Name | 2-[methyl-(2-methyl-4-pentan-3-ylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 142901652 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-[methyl-(2-methyl-4-pentan-3-ylbenzoyl)amino]propanoic acid |
| SMILES | CCC(CC)c1ccc(C(=O)N(C)C(C)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C17H25NO3/c1-6-13(7-2)14-8-9-15(11(3)10-14)16(19)18(5)12(4)17(20)21/h8-10,12-13H,6-7H2,1-5H3,(H,20,21) |
| InChIKey | CTAOPESTCWACAJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |