C10H4F7IO4 — CID 14290169
[(4-fluorophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate (PubChem CID 14290169) has the molecular formula C10H4F7IO4 and a molecular weight of 448.03 g/mol. Its IUPAC name is [(4-fluorophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate.
| Compound Name | [(4-fluorophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 14290169 |
| Molecular Formula | C10H4F7IO4 |
| Molecular Weight | 448.03 g/mol |
| Exact Mass | 447.90 |
| IUPAC Name | [(4-fluorophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OI(OC(=O)C(F)(F)F)c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H4F7IO4/c11-5-1-3-6(4-2-5)18(21-7(19)9(12,13)14)22-8(20)10(15,16)17/h1-4H |
| InChIKey | XXVABJSNMGDSCU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.03 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|