C15H15BrF3NO3 — CID 142901819
4-bromo-3-methylphenol;N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide (PubChem CID 142901819) has the molecular formula C15H15BrF3NO3 and a molecular weight of 394.19 g/mol. Its IUPAC name is 4-bromo-3-methylphenol;N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide.
| Compound Name | 4-bromo-3-methylphenol;N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide |
|---|---|
| PubChem CID | 142901819 |
| Molecular Formula | C15H15BrF3NO3 |
| Molecular Weight | 394.19 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 4-bromo-3-methylphenol;N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide |
| SMILES | C=C/C(NC=O)=C(\C=C)OC(F)(F)F.Cc1cc(O)ccc1Br |
| InChI | InChI=1S/C8H8F3NO2.C7H7BrO/c1-3-6(12-5-13)7(4-2)14-8(9,10)11;1-5-4-6(9)2-3-7(5)8/h3-5H,1-2H2,(H,12,13);2-4,9H,1H3/b7-6-; |
| InChIKey | SZEJDTSEEUDIKW-NAFXZHHSSA-N |
| XLogP | 4.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.19 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|