About N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide
N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide (PubChem CID 142901820) has the molecular formula C8H8F3NO2
and a molecular weight of 207.15 g/mol. Its IUPAC name is N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide.
Molecular Properties
| Compound Name | N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide |
| PubChem CID | 142901820 |
| Molecular Formula | C8H8F3NO2 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide |
| SMILES | C=C/C(NC=O)=C(\C=C)OC(F)(F)F |
| InChI | InChI=1S/C8H8F3NO2/c1-3-6(12-5-13)7(4-2)14-8(9,10)11/h3-5H,1-2H2,(H,12,13)/b7-6- |
| InChIKey | BHLJTZISZYOKDM-SREVYHEPSA-N |
| XLogP | 1.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide?
The IUPAC name of N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide (CID 142901820) is N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide.
What is the SMILES notation for N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide?
The canonical SMILES for N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide is C=C/C(NC=O)=C(\C=C)OC(F)(F)F.
What is the InChIKey of N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide?
The InChIKey is BHLJTZISZYOKDM-SREVYHEPSA-N. The full InChI is InChI=1S/C8H8F3NO2/c1-3-6(12-5-13)7(4-2)14-8(9,10)11/h3-5H,1-2H2,(H,12,13)/b7-6-.
What are the key properties of N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide?
N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide has a molecular weight of 207.15 g/mol, XLogP of 1.85, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z)-4-(trifluoromethoxy)hexa-1,3,5-trien-3-yl]formamide is sourced from PubChem (CID 142901820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).