C21H26F3N3O7S — CID 142901895
ethane;ethyl 4-(3-methoxyphenyl)-2-morpholin-4-yl-6-(trifluoromethylsulfonyloxy)pyrimidine-5-carboxylate (PubChem CID 142901895) has the molecular formula C21H26F3N3O7S and a molecular weight of 521.51 g/mol. Its IUPAC name is ethane;ethyl 4-(3-methoxyphenyl)-2-morpholin-4-yl-6-(trifluoromethylsulfonyloxy)pyrimidine-5-carboxylate.
| Compound Name | ethane;ethyl 4-(3-methoxyphenyl)-2-morpholin-4-yl-6-(trifluoromethylsulfonyloxy)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 142901895 |
| Molecular Formula | C21H26F3N3O7S |
| Molecular Weight | 521.51 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | ethane;ethyl 4-(3-methoxyphenyl)-2-morpholin-4-yl-6-(trifluoromethylsulfonyloxy)pyrimidine-5-carboxylate |
| SMILES | CC.CCOC(=O)c1c(OS(=O)(=O)C(F)(F)F)nc(N2CCOCC2)nc1-c1cccc(OC)c1 |
| InChI | InChI=1S/C19H20F3N3O7S.C2H6/c1-3-31-17(26)14-15(12-5-4-6-13(11-12)29-2)23-18(25-7-9-30-10-8-25)24-16(14)32-33(27,28)19(20,21)22;1-2/h4-6,11H,3,7-10H2,1-2H3;1-2H3 |
| InChIKey | OXSLBJPSKVHNOV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 117.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|