C28H38FN3O — CID 142901995
(E)-N-[(3E,5Z)-3,7-dimethylocta-3,5,7-trien-2-yl]-3-(2-fluoro-6-methylcyclohepta-2,4,6-trien-1-yl)prop-2-enamide;N-[(Z)-2-(ethylideneamino)ethenyl]propan-2-imine (PubChem CID 142901995) has the molecular formula C28H38FN3O and a molecular weight of 451.63 g/mol. Its IUPAC name is (E)-N-[(3E,5Z)-3,7-dimethylocta-3,5,7-trien-2-yl]-3-(2-fluoro-6-methylcyclohepta-2,4,6-trien-1-yl)prop-2-enamide;N-[(Z)-2-(ethylideneamino)ethenyl]propan-2-imine.
| Compound Name | (E)-N-[(3E,5Z)-3,7-dimethylocta-3,5,7-trien-2-yl]-3-(2-fluoro-6-methylcyclohepta-2,4,6-trien-1-yl)prop-2-enamide;N-[(Z)-2-(ethylideneamino)ethenyl]propan-2-imine |
|---|---|
| PubChem CID | 142901995 |
| Molecular Formula | C28H38FN3O |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | (E)-N-[(3E,5Z)-3,7-dimethylocta-3,5,7-trien-2-yl]-3-(2-fluoro-6-methylcyclohepta-2,4,6-trien-1-yl)prop-2-enamide;N-[(Z)-2-(ethylideneamino)ethenyl]propan-2-imine |
| SMILES | C/C=N/C=C\N=C(C)C.C=C(C)/C=C\C=C(/C)C(C)NC(=O)/C=C/C1C=C(C)C=CC=C1F |
| InChI | InChI=1S/C21H26FNO.C7H12N2/c1-15(2)8-6-10-17(4)18(5)23-21(24)13-12-19-14-16(3)9-7-11-20(19)22;1-4-8-5-6-9-7(2)3/h6-14,18-19H,1H2,2-5H3,(H,23,24);4-6H,1-3H3/b8-6-,13-12+,17-10+;6-5-,8-4+ |
| InChIKey | FBSZCKBOLOOZDY-DKAGRTFDSA-N |
| XLogP | 7.14 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|