C21H17FN4O2 — CID 142902215
2-(2-fluorophenyl)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-nitroquinazolin-4-amine (PubChem CID 142902215) has the molecular formula C21H17FN4O2 and a molecular weight of 376.39 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-nitroquinazolin-4-amine.
| Compound Name | 2-(2-fluorophenyl)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 142902215 |
| Molecular Formula | C21H17FN4O2 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-nitroquinazolin-4-amine |
| SMILES | C=C/C=C(\C=C/C)Nc1nc(-c2ccccc2F)nc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C21H17FN4O2/c1-3-7-14(8-4-2)23-21-17-13-15(26(27)28)11-12-19(17)24-20(25-21)16-9-5-6-10-18(16)22/h3-13H,1H2,2H3,(H,23,24,25)/b8-4-,14-7+ |
| InChIKey | HMISMABYKIQLDR-PVJUNDMFSA-N |
| XLogP | 5.40 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|