C30H41F2NO — CID 142902255
1-[3-ethenyl-4-[(Z)-prop-1-enyl]cyclopent-3-en-1-yl]-N-[4-[5-[(1E)-3-ethoxybuta-1,3-dienyl]-2,3-difluorophenyl]butyl]-2-methylpropan-2-amine (PubChem CID 142902255) has the molecular formula C30H41F2NO and a molecular weight of 469.66 g/mol. Its IUPAC name is 1-[3-ethenyl-4-[(Z)-prop-1-enyl]cyclopent-3-en-1-yl]-N-[4-[5-[(1E)-3-ethoxybuta-1,3-dienyl]-2,3-difluorophenyl]butyl]-2-methylpropan-2-amine.
| Compound Name | 1-[3-ethenyl-4-[(Z)-prop-1-enyl]cyclopent-3-en-1-yl]-N-[4-[5-[(1E)-3-ethoxybuta-1,3-dienyl]-2,3-difluorophenyl]butyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 142902255 |
| Molecular Formula | C30H41F2NO |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | 1-[3-ethenyl-4-[(Z)-prop-1-enyl]cyclopent-3-en-1-yl]-N-[4-[5-[(1E)-3-ethoxybuta-1,3-dienyl]-2,3-difluorophenyl]butyl]-2-methylpropan-2-amine |
| SMILES | C=CC1=C(/C=C\C)CC(CC(C)(C)NCCCCc2cc(/C=C/C(=C)OCC)cc(F)c2F)C1 |
| InChI | InChI=1S/C30H41F2NO/c1-7-12-26-19-24(18-25(26)8-2)21-30(5,6)33-16-11-10-13-27-17-23(20-28(31)29(27)32)15-14-22(4)34-9-3/h7-8,12,14-15,17,20,24,33H,2,4,9-11,13,16,18-19,21H2,1,3,5-6H3/b12-7-,15-14+ |
| InChIKey | BZWNFLHITIVIBL-SKRPPKECSA-N |
| XLogP | 8.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|