C20H19F5N2O5S2 — CID 142902681
N-hydroxy-4-[5-[6-(3,3,4,4,4-pentafluorobutyl)-1-azacyclohepta-2,4,5,7-tetraen-2-yl]thiophen-2-yl]sulfonyloxane-4-carboxamide (PubChem CID 142902681) has the molecular formula C20H19F5N2O5S2 and a molecular weight of 526.51 g/mol. Its IUPAC name is N-hydroxy-4-[5-[6-(3,3,4,4,4-pentafluorobutyl)-1-azacyclohepta-2,4,5,7-tetraen-2-yl]thiophen-2-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[5-[6-(3,3,4,4,4-pentafluorobutyl)-1-azacyclohepta-2,4,5,7-tetraen-2-yl]thiophen-2-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142902681 |
| Molecular Formula | C20H19F5N2O5S2 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | N-hydroxy-4-[5-[6-(3,3,4,4,4-pentafluorobutyl)-1-azacyclohepta-2,4,5,7-tetraen-2-yl]thiophen-2-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(C3=CC=C=C(CCC(F)(F)C(F)(F)F)C=N3)s2)CCOCC1 |
| InChI | InChI=1S/C20H19F5N2O5S2/c21-19(22,20(23,24)25)7-6-13-2-1-3-14(26-12-13)15-4-5-16(33-15)34(30,31)18(17(28)27-29)8-10-32-11-9-18/h1,3-5,12,29H,6-11H2,(H,27,28) |
| InChIKey | TZFIJRHOHHHXCG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|