C10H11IO2 — CID 142902920
2-(3-iodophenyl)-1,3-dioxane (PubChem CID 142902920) has the molecular formula C10H11IO2 and a molecular weight of 290.10 g/mol. Its IUPAC name is 2-(3-iodophenyl)-1,3-dioxane.
| Compound Name | 2-(3-iodophenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 142902920 |
| Molecular Formula | C10H11IO2 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 2-(3-iodophenyl)-1,3-dioxane |
| SMILES | Ic1cccc(C2OCCCO2)c1 |
| InChI | InChI=1S/C10H11IO2/c11-9-4-1-3-8(7-9)10-12-5-2-6-13-10/h1,3-4,7,10H,2,5-6H2 |
| InChIKey | VIAGNSLFRJHFSU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|