C23H29ClN2O2 — CID 142903061
1-chloro-3-methylbenzene;formaldehyde;3-methyl-7-(2-pyrrolidin-1-ylethoxy)-1H-indole (PubChem CID 142903061) has the molecular formula C23H29ClN2O2 and a molecular weight of 400.95 g/mol. Its IUPAC name is 1-chloro-3-methylbenzene;formaldehyde;3-methyl-7-(2-pyrrolidin-1-ylethoxy)-1H-indole.
| Compound Name | 1-chloro-3-methylbenzene;formaldehyde;3-methyl-7-(2-pyrrolidin-1-ylethoxy)-1H-indole |
|---|---|
| PubChem CID | 142903061 |
| Molecular Formula | C23H29ClN2O2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-chloro-3-methylbenzene;formaldehyde;3-methyl-7-(2-pyrrolidin-1-ylethoxy)-1H-indole |
| SMILES | C=O.Cc1c[nH]c2c(OCCN3CCCC3)cccc12.Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H20N2O.C7H7Cl.CH2O/c1-12-11-16-15-13(12)5-4-6-14(15)18-10-9-17-7-2-3-8-17;1-6-3-2-4-7(8)5-6;1-2/h4-6,11,16H,2-3,7-10H2,1H3;2-5H,1H3;1H2 |
| InChIKey | SPYVEXHZELOWIQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |