C9H14N2 — CID 142903313
1-cyclohepta-1,4,6-trien-1-yl-1,2-dimethylhydrazine (PubChem CID 142903313) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 1-cyclohepta-1,4,6-trien-1-yl-1,2-dimethylhydrazine.
| Compound Name | 1-cyclohepta-1,4,6-trien-1-yl-1,2-dimethylhydrazine |
|---|---|
| PubChem CID | 142903313 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1-cyclohepta-1,4,6-trien-1-yl-1,2-dimethylhydrazine |
| SMILES | CNN(C)C1=CCC=CC=C1 |
| InChI | InChI=1S/C9H14N2/c1-10-11(2)9-7-5-3-4-6-8-9/h3-5,7-8,10H,6H2,1-2H3 |
| InChIKey | QZKBNGYZAOFBJI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|